Compound Description
| ID: C0538 | Common name: Sinomenine |
| IUPAC: NA | CAS: CAS:115-53-7 |
| Chembl ID: CHEMBL248095 | Pubchem ID: CID:5459308 |
| Formula: C19H23NO4 | TCM-ID: TCMC2676 |
| Smiles: CN1CCC23CC(=O)C(=CC2C1CC4=C3C(=C(C=C4)OC)O)OC | |
| Alias:
9α,13α,14α-Morphinan-6-one, 7,8-didehydro-4-hydroxy-3,7-dimethoxy-17-methyl-;
Sinomenine; (9α,13α,14α)-7,8-Didehydro-4-hydroxy-3,7-dimethoxy-17-methylmorphinan-6-one; Cucoline; Kukoline; Sinomenin |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 1 Reference(s) |
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 |
Q9NZQ7 |
B | 1 Reference(s) |
| T64SK3 | Programmed cell death 1 ligand 2 | PDCD1LG2 |
Q9BQ51 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
| T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
B | 1 Reference(s) |
| T34DZ7 | Interleukin-2 | IL2 |
P60568 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T84XW5 | Placenta growth factor | PGF |
P49763 |
C | 1 Reference(s) |
| T52FON | Death domain-associated protein 6 | DAXX |
Q9UER7 |
C | 1 Reference(s) |
| T06MQM | Heat shock protein beta-1 | HSPB1 |
P04792 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target