Compound Description
| ID: C0566 | Common name: Hesperitin |
| IUPAC: 5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one | CAS: CAS:520-33-2 |
| Chembl ID: CHEMBL88169 | Pubchem ID: CID:3593 |
| Formula: C16H14O6 | TCM-ID: TCMC2873 |
| Smiles: COc1ccc(cc1O)C1CC(=O)c2c(O1)cc(cc2O)O | |
| Alias:
4H-1-Benzopyran-4-one, 2,3-dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (S)-;
Flavanone, 3',5,7-trihydroxy-4'-methoxy-; Hesperetin; (2S)-2,3-Dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one; (-)-Hesperetin; (2S)-5,7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-2,3-dihydrochromen-4-one; (S)-2,3-Dihydro-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one; 3',5,7-Trihydroxy-4'-methoxyflavanone; 5,7,3'-Trihydroxy-4'-methoxyflavanone; Eriodictyol 4'-monomethyl ether; Hesperitin; NSC 57654 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
A | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
A | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
A | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
| T88LSZ | Aromatase | CYP19A1 |
P11511 |
C | 1 Reference(s) |
| T27IAF | Lactoylglutathione lyase | GLO1 |
Q04760 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0813 | Zhi Shi | 枳实 | Seville orange young fruit | Citrus aurantium |
Ckey description of the interaction between compound and target