Compound Description
| ID: C0588 | Common name: Anemonin |
| IUPAC: 4,7-dioxadispiro[4.0.46.25]dodeca-1,9-diene-3,8-dione | CAS: CAS:508-44-1 |
| Chembl ID: CHEMBL1972777 | Pubchem ID: CID:10496 |
| Formula: C10H8O4 | TCM-ID: TCMC3009 |
| Smiles: C1CC2(C13C=CC(=O)O3)C=CC(=O)O2 | |
| Alias:
1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione, trans-;
Anemonin; rel-(5R,6R)-1,7-Dioxadispiro[4.0.4.2]dodeca-3,9-diene-2,8-dione; Anemonine; Pulsatilla camphor; trans-Anemonin; β,β'-(1,2-Dihydroxy-1,2-cyclobutylene)diacrylic acid di-γ-lactone |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T13KGH | Tyrosinase | TYR |
P14679 |
B | 1 Reference(s) |
| T31MUM | 5,6-dihydroxyindole-2-carboxylic acid oxidase | TYRP1 |
P17643 |
B | 1 Reference(s) |
| T82G5G | L-dopachrome tautomerase | DCT |
P40126 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target