Compound Description
| ID: C0601 | Common name: Fructose |
| IUPAC: (2R,3S,4R,5R)-2-(hydroxymethyl)oxane-2,3,4,5-tetrol | CAS: CAS:57-48-7 |
| Chembl ID: NA | Pubchem ID: CID:24310 |
| Formula: C6H12O6 | TCM-ID: TCMC3148 |
| Smiles: OC[C@@]1(O)OC[C@H]([C@H]([C@@H]1O)O)O | |
| Alias:
Fructose, D-;
Advantose FS 95; D-(-)-Fructose; D-(-)-Levulose; D-arabino-2-Hexulose; Fructose; Fruit sugar; Fujifructo L 95; Furucton; HFD 95; Hi-Fructo 970; Hi-Fructo F; Hi-Fructo M 75; Krystar; Krystar 300; Levulose; NF 55; Nevulose; Sugar, fruit |
Structure:
|
Related Targets (Total: 12)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85NRC | Pyruvate kinase PKM | PKM |
P14618 |
A | 1 Reference(s) |
| T55NC2 | Fructose-bisphosphate aldolase B | ALDOB |
P05062 |
C | 1 Reference(s) |
| T78ILO | Stearoyl-CoA desaturase | SCD |
O00767 |
C | 1 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
C | 1 Reference(s) |
| T06CL1 | NA | MIR330 |
NA |
C | 1 Reference(s) |
| T53MEP | Aquaporin-7 | AQP7 |
O14520 |
C | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 1 Reference(s) |
| T17AMT | NA | MIR34A |
NA |
C | 1 Reference(s) |
| T28Z4N | Hepatitis A virus cellular receptor 1 | HAVCR1 |
Q96D42 |
C | 1 Reference(s) |
| T43NBB | Solute carrier family 2, facilitated glucose transporter member 2 | SLC2A2 |
P11168 |
C | 1 Reference(s) |
| T10JEU | Renin receptor | ATP6AP2 |
O75787 |
C | 1 Reference(s) |
| T28V82 | Wilms tumor protein | WT1 |
P19544 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target