Compound Description
| ID: C0620 | Common name: Brasilin |
| IUPAC: (6aS,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,6a,9,10-tetrol | CAS: CAS:474-07-7 |
| Chembl ID: CHEMBL598951 | Pubchem ID: CID:73384 |
| Formula: C16H14O5 | TCM-ID: TCMC3247 |
| Smiles: C1C2=CC(=C(C=C2C3C1(COC4=C3C=CC(=C4)O)O)O)O | |
| Alias:
Benz[b]indeno[1,2-d]pyran-3,6a,9,10(6H)-tetrol, 7,11b-dihydro-, (6aS-cis)-;
Brazilin; (6aS,11bR)-7,11b-Dihydrobenz[b]indeno[1,2-d]pyran-3,6a,9,10(6H)-tetrol; (+)-Brazilin; (6AS,11bR)-7,11b-dihydro-6H-indeno[2,1-c]chromene-3,6a,9,10-tetrol; Brasilin; Braziletto; Hypernic Extract; Limawood Extract; NSC 56652; Pernambuco Extract; Superbresiline |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T24F1A | Pyruvate kinase PKLR | PKLR |
P30613 |
A | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
B | 2 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
| T68SE0 | Solute carrier family 2, facilitated glucose transporter member 4 | SLC2A4 |
P14672 |
B | 1 Reference(s) |
| T82G5G | L-dopachrome tautomerase | DCT |
P40126 |
C | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
C | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
| T63RJO | Growth arrest and DNA damage-inducible protein GADD45 beta | GADD45B |
O75293 |
C | 1 Reference(s) |
| T16IWB | Growth arrest and DNA damage-inducible protein GADD45 alpha | GADD45A |
P24522 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0511 | Su Mu | 苏木 | Sappan caesalpinia | Caesalpinia sappan |
Ckey description of the interaction between compound and target