Compound Description
| ID: C0642 | Common name: Geniposide |
| IUPAC: methyl (1S,4aS,7aS)-7-(hydroxymethyl)-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate | CAS: CAS:24512-63-8 |
| Chembl ID: CHEMBL462894 | Pubchem ID: CID:107848 |
| Formula: C17H24O10 | TCM-ID: TCMC3403 |
| Smiles: COC(=O)C1=COC(C2C1CC=C2CO)OC3C(C(C(C(O3)CO)O)O)O | |
| Alias:
Cyclopenta[c]pyran-4-carboxylic acid, 1-(β-D-glucopyranosyloxy)-1,4a,5,7a-tetrahydro-7-(hydroxymethyl)-, methyl ester, [1S-(1α,4aα,7aα)]-;
Geniposide; Methyl (1S,4aS,7aS)-1-(β-D-glucopyranoside)-7-hydroxymethyl-1,4a,5,7a-tetrahydrocydopenta[c]pyran-4-carboxylate |
Structure:
|
Related Targets (Total: 16)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T30TYH | Phospholipase A2 | PLA2G1B |
P04054 |
A | 1 Reference(s) |
| T75EH8 | Glucagon-like peptide 1 receptor | GLP1R |
P43220 |
A | 2 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
B | 1 Reference(s) |
| T77FOL | Neuromodulin | GAP43 |
P17677 |
B | 1 Reference(s) |
| T87WYU | Glutathione S-transferase Mu 1 | GSTM1 |
P09488 |
B | 1 Reference(s) |
| T48XM4 | Glutathione S-transferase Mu 2 | GSTM2 |
P28161 |
B | 1 Reference(s) |
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
C | 1 Reference(s) |
| T25SMR | Proto-oncogene Wnt-1 | WNT1 |
P04628 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T09KPZ | Vimentin | VIM |
P08670 |
C | 1 Reference(s) |
| T24YWQ | Insulin-degrading enzyme | IDE |
P14735 |
C | 1 Reference(s) |
| T03IB6 | Transcription factor 7-like 2 | TCF7L2 |
Q9NQB0 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target