Compound Description
| ID: C0679 | Common name: Mannose |
| IUPAC: (2S,3S,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol | CAS: CAS:3458-28-4 |
| Chembl ID: CHEMBL365590 | Pubchem ID: CID:185698 |
| Formula: C6H12O6 | TCM-ID: TCMC3695 |
| Smiles: OC[C@H]1O[C@H](O)[C@H]([C@H]([C@@H]1O)O)O | |
| Alias:
Mannose, D-;
(+)-Mannose; Carubinose; D(+)-Mannose; Mannose; NSC 26247; Seminose |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T59NBL | CD209 antigen | CD209 |
Q9NNX6 |
B | 1 Reference(s) |
| T86W77 | Inter-alpha-trypsin inhibitor heavy chain H4 | ITIH4 |
Q14624 |
B | 1 Reference(s) |
| T36QDK | Thyroid peroxidase | TPO |
P07202 |
B | 1 Reference(s) |
| T15EJV | Protein O-mannose kinase | POMK |
Q9H5K3 |
B | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target