Compound Description
| ID: C0685 | Common name: Phorbol |
| IUPAC: 1,6,13,14-tetrahydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyltetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dien-5-one | CAS: CAS:17673-25-5 |
| Chembl ID: NA | Pubchem ID: CID:290670 |
| Formula: C20H28O6 | TCM-ID: TCMC3758 |
| Smiles: OCC1=CC2C3C(C3(C)C)(O)C(C(C2(C2C(C1)(O)C(=O)C(=C2)C)O)C)O | |
| Alias:
5H-Cyclopropa[3,4]benz[1,2-e]azulen-5-one, 1,1a,1b,4,4a,7a,7b,8,9,9a-decahydro-4a,7b,9,9a-tetrahydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-, [1aR-(1aα,1bβ,4aβ,7aα,7bα,8α,9β,9aα)]-;
5H-Cyclopropa[3,4]benz[1,2-e]azulen-5-one, 1,1aα,1bβ,4,4a,7aα,7b,8,9,9a-decahydro-4aβ,7bα,9β,9aα-tetrahydroxy-3-(hydroxymethyl)-1,1,6,8α-tetramethyl-, (+)-; Phorbol; (1aR,1bS,4aR,7aS,7bS,8R,9R,9aS)-1,1a,1b,4,4a,7a,7b,8,9,9a-Decahydro-4a,7b,9,9a-tetrahydroxy-3-(hydroxymethyl)-1,1,6,8-tetramethyl-5H-cyclopropa[3,4]benz[1,2-e]azulen-5-one; (+)-Phorbol; 4β-Phorbol; NSC 154778 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T66GX9 | Proline-rich transmembrane protein 2 | PRRT2 |
Q7Z6L0 |
A | 1 Reference(s) |
| T69ZIZ | DNA dC->dU-editing enzyme APOBEC-3A | APOBEC3A |
P31941 |
C | 1 Reference(s) |
| T19Y64 | DNA dC->dU-editing enzyme APOBEC-3B | APOBEC3B |
Q9UH17 |
C | 1 Reference(s) |
| T25YP8 | Aquaporin-4 | AQP4 |
P55087 |
C | 1 Reference(s) |
| T46PRA | Excitatory amino acid transporter 3 | SLC1A1 |
P43005 |
C | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0869 | Ba Dou | 巴豆 | Pu rging croton | Croton tiglium |
Ckey description of the interaction between compound and target