Compound Description
| ID: C0690 | Common name: Raffinose |
| IUPAC: (2S,3R,4S,5R,6R)-2-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:512-69-6 |
| Chembl ID: CHEMBL603717 | Pubchem ID: CID:439242 |
| Formula: C18H32O16 | TCM-ID: TCMC3804 |
| Smiles: C(C1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3(C(C(C(O3)CO)O)O)CO)O)O)O)O)O)O)O | |
| Alias:
Raffinose;
β-D-Fructofuranosyl O-α-D-galactopyranosyl-(1→6)-α-D-glucopyranoside; D-(+)-Raffinose; D-Raffinose; Gossypose; Meiji Beet Oligo FP; Melitose; Melitriose; NSC 170228; NSC 2025; Nittenraffinose; Oligo GGF |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T05RYU | Alpha-galactosidase A | GLA |
P06280 |
A | 1 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
B | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T65CYN | Solute carrier family 12 member 2 | SLC12A2 |
P55011 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target