Compound Description
| ID: C0696 | Common name: ARB |
| IUPAC: (2S,3R,4S,5S)-oxane-2,3,4,5-tetrol | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:439764 |
| Formula: C5H10O5 | TCM-ID: TCMC3816 |
| Smiles: O[C@H]1CO[C@@H]([C@@H]([C@H]1O)O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T75PC7 | NA | MIR21 |
NA |
C | 2 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
C | 2 Reference(s) |
| T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 1 Reference(s) |
| T74OAM | Bestrophin-1 | BEST1 |
O76090 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T27ST0 | Synaptopodin | SYNPO |
Q8N3V7 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0549 | Tian Zhu Huang | 天竺黄 | Chinese schinzostachyum tabasheer | Concretio silicea bambusae |
Ckey description of the interaction between compound and target