Compound Description
| ID: C0778 | Common name: Tetrandrine |
| IUPAC: (14S)-9,20,21,25-tetramethoxy-15,30-dimethyl-7,23-dioxa-15,30-diazaheptacyclo[22.6.2.23,6.18,12.114,18.027,31.022,33]hexatriaconta-3(36),4,6(35),8,10,12(34),18,20,22(33),24,26,31-dodecaene | CAS: CAS:518-34-3 |
| Chembl ID: NA | Pubchem ID: CID:5321894 |
| Formula: C38H42N2O6 | TCM-ID: TCMC4889 |
| Smiles: COc1c(OC)cc2c3c1Oc1cc4c(cc1OC)CC[NH+](C4Cc1ccc(Oc4cc(C[C@@H]3[NH+](CC2)C)ccc4OC)cc1)C | |
| Alias:
Berbaman, 6,6',7,12-tetramethoxy-2,2'-dimethyl-, (1β)-;
Tetrandrine; (4aS,16aS)-3,4,4a,5,16a,17,18,19-Octahydro-12,21,22,26-tetramethoxy-4,17-dimethyl-16H-1,24 |
Structure:
|
Related Targets (Total: 12)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T38FFJ | Potassium voltage-gated channel subfamily H member 1 | KCNH1 |
O95259 |
A | 3 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 2 Reference(s) |
| T78ZF2 | Protein kinase C alpha type | PRKCA |
P17252 |
A | 1 Reference(s) |
| T00VON | Ceramide glucosyltransferase | UGCG |
Q16739 |
A | 1 Reference(s) |
| T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
C | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
C | 1 Reference(s) |
| T37PX5 | Zinc finger protein GLI1 | GLI1 |
P08151 |
C | 1 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
C | 1 Reference(s) |
| T67X1L | Eukaryotic translation initiation factor 2 subunit 1 | EIF2S1 |
P05198 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0199 | Bei Dou Gen | 北豆根 | Chinese cinquefoil | Menispermum dauricum |
Ckey description of the interaction between compound and target