Compound Description
| ID: C0793 | Common name: Ginkgolide B |
| IUPAC: (1R,3R,6R,7S,8S,10R,11R,12R,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione | CAS: NA |
| Chembl ID: CHEMBL514432 | Pubchem ID: CID:6324617 |
| Formula: C20H24O10 | TCM-ID: TCMC5033 |
| Smiles: O=C1O[C@@H]2[C@@]([C@@H]1C)(O)[C@@]13[C@]4([C@H]2O)[C@H](OC3=O)C[C@H]([C@@]24[C@H](O1)OC(=O)[C@@H]2O)C(C)(C)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T72IYV | Platelet-activating factor receptor | PTAFR |
P25105 |
A | 5 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
A | 1 Reference(s) |
| T77DWZ | PCNA-associated factor | PCLAF |
Q15004 |
A | 1 Reference(s) |
| T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 |
P78380 |
C | 1 Reference(s) |
| T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T67HAF | Signal transducer and activator of transcription 1-alpha/beta | STAT1 |
P42224 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1051 | Bai Guo | 白果 | Ginkgo nut | Ginkgo biloba |
Ckey description of the interaction between compound and target