Compound Description
| ID: C0821 | Common name: Danshensu |
| IUPAC: (2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:11600642 |
| Formula: C9H10O5 | TCM-ID: TCMC5733 |
| Smiles: [O-]C(=O)[C@@H](Cc1ccc(c(c1)O)O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
C | 1 Reference(s) |
| T32YN4 | GTPase HRas | HRAS |
P01112 |
C | 1 Reference(s) |
| T21UJU | Troponin I, cardiac muscle | TNNI3 |
P19429 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0949 | Dan Shen | 丹参 | The root of red-rooted salvia | Salvia miltiorrhiza |
Ckey description of the interaction between compound and target