Compound Description
| ID: C0850 | Common name: Curcumol |
| IUPAC: (1S,2S,5S,8R,9S)-2-methyl-6-methylidene-9-propan-2-yl-11-oxatricyclo[6.2.1.01,5]undecan-8-ol | CAS: CAS:4871-97-0 |
| Chembl ID: NA | Pubchem ID: CID:14240392 |
| Formula: C15H24O2 | TCM-ID: TCMC6121 |
| Smiles: CC([C@@H]1C[C@]23O[C@]1(O)CC(=C)[C@@H]3CC[C@@H]2C)C | |
| Alias:
5β-Guai-10(14)-en-8-ol, 5,8-epoxy-, (-)-;
6H-3a,6-Epoxyazulen-6-ol, octahydro-3-methyl-8-methylene-5-(1-methylethyl)-, [3S-(3α,3aα,5β,6β,8aβ)]-; 6H-3a,6-Epoxyazulen-6-ol, octahydro-5-isopropyl-3-methyl-8-methylene-; (3S,3aS,5S,6R,8aS)-Octahydro-3-methyl-8-methylene-5-(1-methylethyl)-6H-3a,6-epoxyazulen-6-ol; (-)-Curcumol; 8α-Hydroxy-1α,4α,7βH-guai-10(15)-en-5β,8β-endoxide; Curcumol |
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T31U13 | Cytochrome P450 2C19 | CYP2C19 |
P33261 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 2 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
C | 1 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
C | 1 Reference(s) |
| T74QOR | Tyrosine-protein kinase JAK3 | JAK3 |
P52333 |
C | 1 Reference(s) |
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
C | 1 Reference(s) |
| T41A2B | Nucleolin | NCL |
P19338 |
C | 1 Reference(s) |
| T57R3V | Proliferation marker protein Ki-67 | MKI67 |
P46013 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0028 | Jiang Huang | 姜黄 | Common turmeric | Curcuma longa |
Ckey description of the interaction between compound and target