Compound Description
| ID: C0930 | Common name: Astragaloside Iv |
| IUPAC: (2R,3R,4S,5S,6R)-2-[[(1S,3R,6S,8S,9S,11S,12S,14S,15R,16R)-14-hydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-9-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol | CAS: CAS:84687-43-4 |
| Chembl ID: NA | Pubchem ID: CID:124761776 |
| Formula: C41H68O14 | TCM-ID: TCMC7338 |
| Smiles: OC[C@H]1O[C@@H](O[C@H]2C[C@@H]3[C@]4([C@@]5([C@H]2C(C)(C)[C@H](CC5)O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)C4)CC[C@]2([C@@]3(C)C[C@@H]([C@@H]2[C@@]2(C)CC[C@H](O2)C(O)(C)C)O)C)[C@@H]([C@H]([C@@H]1O)O)O | |
| Alias:
(3β,6α,16β,20R,24S)-20,24-Epoxy-16,25-dihydroxy-3-(β-D-xylopyranosyloxy)-9,19-cyclolanostan-6-yl β-D-glucopyranoside;
1H,19H-Cyclopropa[9,10]cyclopenta[a]phenanthrene, β-D-glucopyranoside deriv.; 9,19-Cyclolanostane, β-D-glucopyranoside deriv.; Astragaloside IV; Astrasieversianin XIV; Astraversianin XIV; Cyclosieversioside F; Cyclosiversioside F |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 |
Q6UUV9 |
A | 1 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
B | 1 Reference(s) |
| T00YE6 | CD276 antigen | CD276 |
Q5ZPR3 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T73V21 | Transcription factor SOX-2 | SOX2 |
P48431 |
C | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1247 | Huang Qi | 黄芪 | Membranous milkvetch | Astragalus membranaceus |
Ckey description of the interaction between compound and target