Compound Description
| ID: C0933 | Common name: Fucoidan |
| IUPAC: [(2S,3S,4S,5S,6R)-4-hydroxy-5-methoxy-2,6-dimethyloxan-3-yl] hydrogen sulfate | CAS: NA |
| Chembl ID: NA | Pubchem ID: CID:129532628 |
| Formula: C8H16O7S | TCM-ID: TCMC7355 |
| Smiles: CO[C@@H]1[C@@H](C)O[C@H]([C@H]([C@H]1O)OS(=O)(=O)[O-])C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 19)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T13KGH | Tyrosinase | TYR |
P14679 |
A | 1 Reference(s) |
| T07NML | P-selectin | SELP |
P16109 |
A | 1 Reference(s) |
| T02D3S | C-type lectin domain family 2 member B | CLEC2B |
Q92478 |
A | 1 Reference(s) |
| T05WLN | C-type lectin domain family 2 member A | CLEC2A |
Q6UVW9 |
A | 1 Reference(s) |
| T55L5P | Macrophage scavenger receptor types I and II | MSR1 |
P21757 |
A | 2 Reference(s) |
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
A | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
A | 1 Reference(s) |
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
C | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
| T58CL2 | C-type lectin domain family 1 member B | CLEC1B |
Q9P126 |
C | 2 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
C | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
C | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1154 | Hai Zao | 海藻 | seaweed | Sargassum |
Ckey description of the interaction between compound and target