Compound Description
| ID: C0949 | Common name: indirubin |
| IUPAC: (2E)-2-(2-oxo-1H-indol-3-ylidene)-1H-indol-3-one | CAS: CAS:479-41-4 |
| Chembl ID: NA | Pubchem ID: CID:5359405 |
| Formula: C16H10N2O2 | TCM-ID: TCMC7393 |
| Smiles: C1=CC=C2C(=C1)C(=C3C(=O)C4=CC=CC=C4N3)C(=O)N2 | |
| Alias:
Indirubin (6CI);
[2,3'-Biindoline]-2',3-dione (7CI,8CI); C.I. 73200; Couroupitine B; Indigo red; Indigopurpurin; NSC 105327 |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
A | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 2 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
| T18SKL | C-C motif chemokine 5 | CCL5 |
P13501 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target