Compound Description
| ID: C0961 | Common name: uridine |
| IUPAC: 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione | CAS: CAS:58-96-8 |
| Chembl ID: CHEMBL68846 | Pubchem ID: CID:1177 |
| Formula: C9H12N2O6 | TCM-ID: TCMC7404 |
| Smiles: C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O | |
| Alias:
Uracil, 1-beta-D-ribofuranosyl- (7CI);
1-beta-D-Ribofuranosyl-2,4(1H,3H)-pyrimidinedione; 1-beta-D-Ribofuranosyluracil; NSC 20256; Uridin; beta-D-Ribofuranoside, 2,4(1H,3H)-pyrimidinedione-1; beta-Uridine |
Structure:
|
Related Targets (Total: 2)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T40LTN | Phospholipase A2, membrane associated | PLA2G2A |
P14555 |
B | 1 Reference(s) |
| T99S78 | Interferon alpha/beta receptor 2 | IFNAR2 |
P48551 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target