Compound Description
| ID: C0965 | Common name: taxifolin |
| IUPAC: 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methyl-2,3-dihydrochromen-4-one | CAS: CAS:480-18-2 |
| Chembl ID: NA | Pubchem ID: CID:5321695 |
| Formula: C16H14O6 | TCM-ID: TCMC7408 |
| Smiles: CC1C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O | |
| Alias:
4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R-trans)-;
Flavanone, 3,3',4',5,7-pentahydroxy- (8CI); (+)-Dihydroquercetin; (+)-Taxifolin; (2R,3R)-(+)-Taxifolin; (2R,3R)-Dihydroquercetin; 2,3-Dihydroquercetin; 3,5,7,3',4'-Pentahydroxyflavanone; Dihydroquercetin; Diquertin; Distylin; Lariksin; Taxifolin; Taxifoliol |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T49M88 | Diacylglycerol O-acyltransferase 2 | DGAT2 |
Q96PD7 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T35FQV | Microsomal triglyceride transfer protein large subunit | MTTP |
P55157 |
B | 1 Reference(s) |
| T73S71 | Apolipoprotein B-100 | APOB |
P04114 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T51FD6 | Metal-binding activator 1 | MAC1 |
P35192 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target