Compound Description
| ID: C0969 | Common name: enoxaparin |
| IUPAC: 4S,6R)-6-[(2R,4R)-4,6-dihydroxy-5-(sulfonatoamino)-2-(sulfonatooxymethyl)oxan-3-yl]oxy-3,4-dihydroxy-5-sulfonatooxyoxane-2-carboxylate | CAS: CAS:9005-49-6 |
| Chembl ID: NA | Pubchem ID: CID:25244225 |
| Formula: NA | TCM-ID: TCMC7412 |
| Smiles: C(C1C(C(C(C(O1)O)NS(=O)(=O)[O-])O)OC2C(C(C(C(O2)C(=O)[O-])O)O)OS(=O)(=O)[O-])OS(=O)(=O)[O-] | |
| Alias:
Ardeparin;
Arteven; Bemiparin; CY 216; CY 222; Centaxarin; Certoparin; Clevarin; Clivarin; Clivarine; Dalteparin; Deligoparin; F 202; FR 860; Fluxum; Fragmin A; Fragmin B; Fraxiparin; Gammaparin; H 5284; H 9399; Hapacarin; Heparin subcutan; Heparin sulfate; Heparinic acid; KB 101; Leparan; Livaracine; M 118REH; Mono-embolex; Multiparin; Nadroparin; Nadroparine; Novoheparin; OP 386; OP 622; Octaparin; Pabyrn; Parnaparin; Parvoparin; Reviparin; Sandoparin; Subeparin; Sublingula; Tinzaparin; Triofiban; Vetren; Vitrum AB; alpha-Heparin |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T19CUN | Prothrombin | F2 |
P00734 |
A | 1 Reference(s) |
| T07NML | P-selectin | SELP |
P16109 |
B | 1 Reference(s) |
| T18WSE | L-selectin | SELL |
P14151 |
B | 1 Reference(s) |
| T14Q85 | Heparanase | HPSE |
Q9Y251 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target