Compound Description
| ID: C0974 | Common name: dihydroartemisinin |
| IUPAC: NA | CAS: CAS:71939-50-9 |
| Chembl ID: NA | Pubchem ID: CID:107770 |
| Formula: C15H24O5 | TCM-ID: TCMC7417 |
| Smiles: CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)O)C | |
| Alias:
3,12-Epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-ol, decahydro-3,6,9-trimethyl-, [3R-(3alpha,5abeta,6beta,8abeta,9alpha,10alpha,12beta,12aR*)]-;
Alaxin; Cotecxin; Cotexin; DHQHS 2; Dihydroartemisinin; Dihydroartemisinine; Dihydroqinghaosu; Dynamax; Salaxin; Santecxin; beta-Dihydroartemisinin |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
C | 1 Reference(s) |
| T84WE9 | Vascular endothelial growth factor receptor 1 | FLT1 |
P17948 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target