Compound Description
| ID: C1008 | Common name: Atrazine |
| IUPAC: 6-chloro-4-N-ethyl-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine | CAS: NA |
| Chembl ID: CHEMBL15063 | Pubchem ID: CID:2256 |
| Formula: C8H14ClN5 | TCM-ID: TCMC745 |
| Smiles: CCN=c1nc(Cl)[nH]c(=NC(C)C)[nH]1 | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T87WYU | Glutathione S-transferase Mu 1 | GSTM1 |
P09488 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T32YAJ | G-protein coupled estrogen receptor 1 | GPER1 |
Q99527 |
B | 1 Reference(s) |
| T39NNK | Growth hormone-releasing hormone receptor | GHRHR |
Q02643 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0075 | Jing Mi | 粳米 | Rice | Oryza sativa |
Ckey description of the interaction between compound and target