Compound Description
| ID: C1025 | Common name: emetine |
| IUPAC: (2S,3R,11bS)-2-[[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline | CAS: CAS:483-18-1 |
| Chembl ID: CHEMBL50588 | Pubchem ID: CID:10219 |
| Formula: C29H40N2O4 | TCM-ID: TCMC7465 |
| Smiles: CCC1CN2CCC3=CC(=C(C=C3C2CC1CC4C5=CC(=C(C=C5CCN4)OC)OC)OC)OC | |
| Alias:
Emetan, 6',7',10,11-tetramethoxy-;
Emetine (8CI); (-)-Emetine; Cephaeline methyl ether; Emetin; NSC 33669 |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 1 Reference(s) |
| T11R4S | Tumor necrosis factor receptor superfamily member 5 | CD40 |
P25942 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target