Compound Description
| ID: C1036 | Common name: inulin |
| IUPAC: (2R,3S,4S,5R)-2-[[(2R,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxymethyl]-5-(hydroxymethyl)oxolane-2,3,4-triol | CAS: CAS:9005-80-5 |
| Chembl ID: NA | Pubchem ID: CID:439552 |
| Formula: (C6H10O5)6 | TCM-ID: TCMC7475 |
| Smiles: C(C1C(C(C(O1)(CO)OCC2(C(C(C(O2)CO)O)O)O)O)O)O | |
| Alias:
Alant starch;
Alantin; Beneo; Beneo GR; Beneo HP; Beneo ST; Dahlin; Fibruline; Fibruline Instant; Fibruline LC; Fibruline Long Chain; Fibrulose; Frutafit; Frutafit EXL; Frutafit HD; Frutafit IQ; Frutafit TEX; Frutagave PR 95; Frutagave SP 70; Fuji FF; Inulin HD; Inulin IQ; Inutec N 10GR; Inutec N 25; LV 110; Oliggo-Fiber F 97; Oliggo-Fiber XL; Raftifeed IPS; Raftiline; Raftiline GR; Raftiline HP; Raftiline LS; Raftiline ST; Sinantrin; Synantherin; Synanthrin; Synantrin; Ticaloid LC-CSR 2 |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
B | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 1 Reference(s) |
| T32JN2 | Beta-glucuronidase | GUSB |
P08236 |
B | 1 Reference(s) |
| T95KEX | Ferritin, mitochondrial | FTMT |
Q8N4E7 |
C | 1 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
C | 1 Reference(s) |
| T18YTV | Natural resistance-associated macrophage protein 2 | SLC11A2 |
P49281 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target