Compound Description
| ID: C1055 | Common name: salvianolic acid b |
| IUPAC: 3-(3,4-dihydroxyphenyl)-2-[(2S,3S)-2-(3,4-dihydroxyphenyl)-4-[(E)-3-[(2R)-3-(3,4-dihydroxyphenyl)-1-hydroxy-1-oxopropan-2-yl]oxy-3-oxoprop-1-enyl]-7-hydroxy-2,3-dihydro-1-benzofuran-3-carbonyl]oxypropanoic acid | CAS: CAS:121521-90-2 |
| Chembl ID: NA | Pubchem ID: CID:6449855 |
| Formula: C36H30O16 | TCM-ID: TCMC7493 |
| Smiles: C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=C3C(C(OC3=C(C=C2)O)C4=CC(=C(C=C4)O)O)C(=O)OC(CC5=CC(=C(C=C5)O)O)C(=O)O)O)O | |
| Alias:
3-Benzofurancarboxylic acid, 4-[(1E)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propenyl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, (2S,3S)- (9CI);
3-Benzofurancarboxylic acid, 4-[3-[1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propenyl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, [2S-[2alpha,3beta(S*),4[E(S*)]]]-; Dan Shen Suan B; Danfensuan B; Lithospermic acid B; Salvianolic acid B |
Structure:
|
Related Targets (Total: 13)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T69NNS | PRKC apoptosis WT1 regulator protein | PAWR |
Q96IZ0 |
C | 1 Reference(s) |
| T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
C | 1 Reference(s) |
| T73HTV | Thrombomodulin | THBD |
P07204 |
C | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target