Compound Description
| ID: C1057 | Common name: cortisone |
| IUPAC: 17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3,11-dione | CAS: CAS:53-06-5 |
| Chembl ID: CHEMBL1497313 | Pubchem ID: CID:521440 |
| Formula: C21H28O5 | TCM-ID: TCMC7495 |
| Smiles: CC12CCC(=O)C=C1CCC3C2C(=O)CC4(C3CCC4(C(=O)CO)O)C | |
| Alias:
Cortisone (8CI);
11-Dehydro-17-hydroxycorticosterone; 17,21-Dihydroxypregn-4-ene-3,11,20-trione; 17-Hydroxy-11-dehydrocorticosterone; 17alpha,21-Dihydroxy-4-pregnene-3,11,20-trione; 17alpha,21beta-Dihydroxy-4-pregnene-3,11,20-trione; 17alpha-Hydroxy-11-dehydrocorticosterone; Adrenalex; Compound E; Cortisate; Cortivite; Cortogen; Cortone; KE; Kendall's compound E; NSC 9703; Pregn-4-en-17alpha,21-diol-3,11,20-trione; Reichstein's substance Fa; Wintersteiner's compound F; 4-Pregnene-17alpha,21-diol-3,11,20-trione |
Structure:
|
Related Targets (Total: 4)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T01SWU | Early activation antigen CD69 | CD69 |
Q07108 |
B | 1 Reference(s) |
| T77A47 | Eukaryotic translation initiation factor 4E | EIF4E |
P06730 |
B | 1 Reference(s) |
| T92E71 | Corticosteroid 11-beta-dehydrogenase isozyme 2 | HSD11B2 |
P80365 |
C | 1 Reference(s) |
| T74JJN | Fatty acid synthase | FASN |
P49327 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target