Compound Description
| ID: C1067 | Common name: hirudin |
| IUPAC: NA | CAS: CAS:8001-27-2 |
| Chembl ID: NA | Pubchem ID: CID:16130959 |
| Formula: NA | TCM-ID: TCMC7505 |
| Smiles: CCC(C)C(C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)N(C(CC(C)C)C(=O)OS(=O)(=O)O)C(=O)C(CC2=CC=C(C=C2)O)N)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CC(=O)O)NC(=O)CNC(=O)C(CC(=O)N)N | |
| Alias:
Exhirud;
Exhirudine; Hirudex |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T19CUN | Prothrombin | F2 |
P00734 |
A | 4 Reference(s) |
| T17CZC | Tissue factor | F3 |
P13726 |
B | 1 Reference(s) |
| T89GFN | Macrophage migration inhibitory factor | MIF |
P14174 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target