Compound Description
| ID: C1074 | Common name: solamargine |
| IUPAC: NA | CAS: CAS:20311-51-7 |
| Chembl ID: CHEMBL2005327 | Pubchem ID: CID:437080 |
| Formula: C45H73NO15 | TCM-ID: TCMC7512 |
| Smiles: CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)NC1 | |
| Alias:
Solamargine (6CI,7CI,8CI);
NSC 407810; Solamargin; alpha-Solamargine; delta-Solanigrine |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T38K2W | Receptor tyrosine-protein kinase erbB-2 | ERBB2 |
P04626 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
| T77INT | Lymphotoxin-alpha | LTA |
P01374 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target