Compound Description
| ID: C1087 | Common name: glycyrrhetinic acid |
| IUPAC: 10-hydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,6a,7,8,8a,10,11,12,14b-dodecahydro-1H-picene-2-carboxylic acid | CAS: CAS:471-53-4 |
| Chembl ID: CHEMBL1863561 | Pubchem ID: CID:3230 |
| Formula: C30H46O4 | TCM-ID: TCMC7525 |
| Smiles: CC1(C2CCC3(C(C2(CCC1O)C)C(=O)C=C4C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C | |
| Alias:
Olean-12-en-30-oic acid, 3beta-hydroxy-11-oxo- (8CI);
Uralenic acid (7CI); 18beta-Glycyrrhetic acid; 18beta-Glycyrrhetinic acid; Arthrodont; Biosone; Enoxolone; GM 1658; Glycyrrhetic acid; Glycyrrhetin; Glycyrrhetinic acid; NSC 35347; PO 12; STX 352; Subglycyrrhelinic acid; alpha-Glycyrrhetinic acid |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T23IBY | DNA polymerase beta | POLB |
P06746 |
A | 1 Reference(s) |
| T41B2A | DNA polymerase kappa | POLK |
Q9UBT6 |
A | 1 Reference(s) |
| T92E71 | Corticosteroid 11-beta-dehydrogenase isozyme 2 | HSD11B2 |
P80365 |
B | 4 Reference(s) |
| T70HTD | Cytochrome P450 2E1 | CYP2E1 |
P05181 |
B | 1 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target