Compound Description
| ID: C1110 | Common name: lutein |
| IUPAC: (4R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-2-en-1-ol | CAS: CAS:127-40-2 |
| Chembl ID: NA | Pubchem ID: CID:6433159 |
| Formula: C40H56O2 | TCM-ID: TCMC7546 |
| Smiles: CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CC(CC2(C)C)O)C)C)C | |
| Alias:
(3R,3'R,6'R)-Lutein;
(all-E)-Lutein; 6'-Hydro-4',5'-dehydro-beta-carotene-3,3'-diol; Bo-Xan; E 161; E 161b; FloraGLO; FloraGLO Lutein; Lutein; Lutein A; Luteine; OS 24; Oro Glo 7; Vegetable lutein; Vegetable luteol; Xanthophyll; all-trans-(+)-Xanthophyll; all-trans-Lutein; all-trans-Xanthophyll; trans-Lutein |
Structure:
|
Related Targets (Total: 16)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 1 Reference(s) |
| T87QBF | Alkaline phosphatase, tissue-nonspecific isozyme | ALPL |
P05186 |
A | 1 Reference(s) |
| T46E53 | Retinoic acid receptor alpha | RARA |
P10276 |
B | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
B | 1 Reference(s) |
| T68BGR | Glial fibrillary acidic protein | GFAP |
P14136 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T68PZ0 | Elastin | ELN |
P15502 |
B | 1 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
B | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 3 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
C | 1 Reference(s) |
| T37BP1 | Serine/threonine-protein kinase pim-1 | PIM1 |
P11309 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target