Compound Description
| ID: C1127 | Common name: gossypin |
| IUPAC: 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | CAS: CAS:652-78-8 |
| Chembl ID: CHEMBL402915 | Pubchem ID: CID:5281621 |
| Formula: C21H20O13 | TCM-ID: TCMC7561 |
| Smiles: C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)OC4C(C(C(C(O4)CO)O)O)O)O)O)O | |
| Alias:
Gossypin (6CI,7CI,8CI);
Gossypetin 8-glucoside |
Structure:
|
Related Targets (Total: 15)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T54VET | Protein tyrosine phosphatase type IVA 3 | PTP4A3 |
O75365 |
A | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T14JSQ | Baculoviral IAP repeat-containing protein 2 | BIRC2 |
Q13490 |
C | 1 Reference(s) |
| T14LSK | E3 ubiquitin-protein ligase XIAP | XIAP |
P98170 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
| T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target