Compound Description
| ID: C1133 | Common name: atropine |
| IUPAC: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate | CAS: CAS:51-55-8 |
| Chembl ID: CHEMBL254656 | Pubchem ID: CID:174174 |
| Formula: C17H23NO3 | TCM-ID: TCMC7567 |
| Smiles: CN1C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3 | |
| Alias:
1alphaH,5alphaH-Tropan-3alpha-ol (±)-tropate (ester) (8CI);
Benzeneacetic acid, alpha-(hydroxymethyl)-, 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, endo-; (±)-Atropine; (±)-Hyoscyamine; Atropin; Atropine; DL-Hyoscyamine; Tropine (±)-tropate; Tropine tropate; dl-Hyoscyamine; dl-Tropyl tropate |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T75EH8 | Glucagon-like peptide 1 receptor | GLP1R |
P43220 |
A | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T68J1I | Neuronal acetylcholine receptor subunit alpha-9 | CHRNA9 |
Q9UGM1 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 3 Reference(s) |
| T31QEZ | 5-hydroxytryptamine receptor 1A | HTR1A |
P08908 |
B | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
B | 3 Reference(s) |
| T85TN5 | Promotilin [Cleaved into: Motilin; Motilin-associated peptide | MLN |
P12872 |
B | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
B | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
C | 1 Reference(s) |
| T96QF8 | Pancreatic prohormone | PPY |
P01298 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target