Compound Description
| ID: C1160 | Common name: withaferin a |
| IUPAC: NA | CAS: CAS:5119-48-2 |
| Chembl ID: CHEMBL517080 | Pubchem ID: CID:265237 |
| Formula: C28H38O6 | TCM-ID: TCMC7593 |
| Smiles: CC1=C(C(=O)OC(C1)C(C)C2CCC3C2(CCC4C3CC5C6(C4(C(=O)C=CC6O)C)O5)C)CO | |
| Alias:
5beta-Ergosta-2,24-dien-26-oic acid, 5,6beta-epoxy-4beta,22,27-trihydroxy-1-oxo-, delta-lactone, (20S,22R)- (8CI);
Withaferin A (7CI); 5,6-Epoxy-5H-cyclopenta[a]phenanthrene, ergosta-2,24-dien-26-oic acid deriv.; NSC 101088; NSC 273757; Withaferine; Withaferine A |
Structure:
|
Related Targets (Total: 11)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T09KPZ | Vimentin | VIM |
P08670 |
A | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 2 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
C | 1 Reference(s) |
| T16KVU | Tumor necrosis factor receptor superfamily member 1A | TNFRSF1A |
P19438 |
C | 1 Reference(s) |
| T90ADC | BH3-interacting domain death agonist | BID |
P55957 |
C | 1 Reference(s) |
| T06MQM | Heat shock protein beta-1 | HSPB1 |
P04792 |
C | 1 Reference(s) |
| T73EVE | Cyclic AMP-dependent transcription factor ATF-2 | ATF2 |
P15336 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target