Compound Description
| ID: C1274 | Common name: Cytidine 5'-Phosphate |
| IUPAC: [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | CAS: CAS:63-37-6 |
| Chembl ID: CHEMBL307679 | Pubchem ID: CID:6131 |
| Formula: C9H14N3O8P | TCM-ID: TCMC979 |
| Smiles: O[C@@H]1[C@H](O)[C@H](O[C@H]1n1ccc(=N)nc1O)COP(=O)(O)O | |
| Alias:
5'-CMP;
CMP; CMP (nucleotide); Cytidine 5'-(dihydrogen phosphate); Cytidine 5'-monophosphate; Cytidine 5'-monophosphoric acid; Cytidine 5'-phosphate; Cytidine 5'-phosphoric acid; Cytidine monophosphate; Cytidine, mono(dihydrogen phosphate) (ester); Cytidylic acid; Cytosine 5'-monophosphate |
Structure:
|
Related Targets (Total: 6)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T05PVA | Alpha-2,8-sialyltransferase 8B | ST8SIA2 |
Q92186 |
A | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T57FUN | Beclin-1 | BECN1 |
Q14457 |
C | 1 Reference(s) |
| T37SV3 | Occludin | OCLN |
Q16625 |
C | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
C | 1 Reference(s) |
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 |
Q9NZQ7 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target