Compound Description
| ID: C0006 | Common name: Deoxycholic Acid |
| IUPAC: (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | CAS: CAS:83-44-3 |
| Chembl ID: CHEMBL406393 | Pubchem ID: CID:222528 |
| Formula: C24H40O4 | TCM-ID: TCMC1012 |
| Smiles: CC(CCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C | |
| Alias:
5β-Cholan-24-oic acid, 3α,12α-dihydroxy-;
(3α,5β,12α)-3,12-Dihydroxycholan-24-oic acid; 17β-[1-Methyl-3-carboxypropyl]-etiocholane-3α,12α-diol; 3α,12α-Dihydroxy-5β-cholan-24-oic acid; 3α,12α-Dihydroxy-5β-cholanic acid; 3α,12α-Dihydroxy-5β-cholanoic acid; 3α,12α-Dihydroxycholanic acid; 5β-Cholanic acid-3α,12α-diol; 5β-Deoxycholic acid; 7-Deoxycholic acid; ATX 101; Cholerebic; Cholic acid, deoxy-; Cholorebic; Degalol; Deoxycholatic acid; Deoxycholic acid; Desoxycholic acid; Droxolan; Kybella; NSC 8797; Pyrochol; Septochol |
Structure:
|
Related Targets (Total: 20)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 1 Reference(s) |
| T74P7I | G-protein coupled bile acid receptor 1 | GPBAR1 |
Q8TDU6 |
A | 1 Reference(s) |
| T83TMF | Cytochrome P450 2B1 | Cyp2b1 |
P00176 |
B | 1 Reference(s) |
| T06IYF | Adenomatous polyposis coli protein | APC |
P25054 |
B | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
B | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
B | 1 Reference(s) |
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
B | 1 Reference(s) |
| T70HTD | Cytochrome P450 2E1 | CYP2E1 |
P05181 |
B | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
B | 1 Reference(s) |
| T02OHU | Mucin-2 | MUC2 |
Q02817 |
C | 1 Reference(s) |
| T14JSQ | Baculoviral IAP repeat-containing protein 2 | BIRC2 |
Q13490 |
C | 1 Reference(s) |
| T94K7H | Cytochrome P450 7A1 | CYP7A1 |
P22680 |
C | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
C | 1 Reference(s) |
| T43VRB | Fibroblast growth factor 19 | FGF19 |
O95750 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T75PC7 | NA | MIR21 |
NA |
C | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 1 Reference(s) |
| T87LDJ | CDK2-associated and cullin domain-containing protein 1 | CACUL1 |
Q86Y37 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target