Compound Description
| ID: C0068 | Common name: Evodiamine |
| IUPAC: NA | CAS: CAS:518-17-2 |
| Chembl ID: CHEMBL486598 | Pubchem ID: CID:6971167 |
| Formula: C19H17N3O | TCM-ID: TCMC1166 |
| Smiles: O=C1c2ccccc2N([C@@H]2N1CCc1c2[nH]c2c1cccc2)C | |
| Alias:
Evodiamine;
Indolo[2',3' |
Structure:
|
Related Targets (Total: 11)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T67KTV | Transient receptor potential cation channel subfamily V member 1 | TRPV1 |
Q8NER1 |
A | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
B | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 2 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
C | 2 Reference(s) |
| T25RHJ | Sodium-dependent serotonin transporter | SLC6A4 |
P31645 |
C | 1 Reference(s) |
| T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
C | 1 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T43TK1 | Protein LYRIC | MTDH |
Q86UE4 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0616 | Wu Zhu Yu | 吴茱萸 | Medicinal evodia | Evodia rutaecarpa |
Ckey description of the interaction between compound and target