Compound Description
| ID: C0238 | Common name: Nandrolone |
| IUPAC: (8R,9S,10R,13S,14S,17S)-17-hydroxy-13-methyl-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one | CAS: CAS:434-22-0 |
| Chembl ID: CHEMBL757 | Pubchem ID: CID:9904 |
| Formula: C18H26O2 | TCM-ID: TCMC1726 |
| Smiles: O=C1CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2O)C | |
| Alias:
Estr-4-en-3-one, 17β-hydroxy-;
(17β)-17-Hydroxyestr-4-en-3-one; (+)-19-Nortestosterone; (17β)-19-Nortestosterone; 17β-Hydroxy-19-nor-4-androsten-3-one; 17β-Hydroxyestr-4-en-3-one; 17β-Nandrolone; 17β-Nortestosterone; 19-Nor-17β-hydroxy-3-ketoandrost-4-ene; 19-Norandrostenolone; 19-Nortestosterone; 4-Estren-17β-ol-3-one; 4-Estren-3-one-17β-ol; Biobol; Hybolin; Menidrabol; NSC 3351; Nandrolon; Nandrolone; Norandrostenolon; Norandrostenolone; Nortestonate; Nortestosterone; Oestrenolon; d-13β-Methyl-17β-hydroxygon-4-en-3-one; Δ4-Estren-17β-ol-3-one; β-Nortestosterone |
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T20JZ2 | Androgen receptor | AR |
P10275 |
A | 1 Reference(s) |
| T08W1L | Tumor necrosis factor receptor superfamily member 16 | NGFR |
P08138 |
C | 1 Reference(s) |
| T98LR5 | DNA damage-inducible transcript 4-like protein | DDIT4L |
Q96D03 |
C | 1 Reference(s) |
| T11UVV | Calcipressin-2 | RCAN2 |
Q14206 |
C | 1 Reference(s) |
| T06PVX | E3 ubiquitin-protein ligase Mdm2 | MDM2 |
Q00987 |
C | 1 Reference(s) |
| T85K8L | Forkhead box protein O1 | FOXO1 |
Q12778 |
C | 1 Reference(s) |
| T83QHM | Beta-nerve growth factor | NGF |
P01138 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target