Compound Description
| ID: C0402 | Common name: Shogaol |
| IUPAC: (E)-1-(4-hydroxy-3-methoxyphenyl)dec-4-en-3-one | CAS: CAS:555-66-8 |
| Chembl ID: CHEMBL25948 | Pubchem ID: CID:5281794 |
| Formula: C17H24O3 | TCM-ID: TCMC2070 |
| Smiles: CCCCCC=CC(=O)CCC1=CC(=C(C=C1)O)OC | |
| Alias:
1-(4-Hydroxy-3-methoxyphenyl)-4-decen-3-one;
Shogaol; [6]-Shogaol |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T66FP0 | cAMP-specific 3',5'-cyclic phosphodiesterase 4D | PDE4D |
Q08499 |
A | 1 Reference(s) |
| T91X7D | Phosphatidylinositol 3-kinase catalytic subunit type 3 | PIK3C3 |
Q8NEB9 |
B | 1 Reference(s) |
| T67X1L | Eukaryotic translation initiation factor 2 subunit 1 | EIF2S1 |
P05198 |
C | 1 Reference(s) |
| T02GD4 | Tumor necrosis factor ligand superfamily member 6 | FASLG |
P48023 |
C | 1 Reference(s) |
| T63W0D | DNA damage-inducible transcript 3 protein | DDIT3 |
P35638 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
| T74JJN | Fatty acid synthase | FASN |
P49327 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target