Compound Description
| ID: C0404 | Common name: Silybin B |
| IUPAC: (2R,3R)-3,5,7-trihydroxy-2-[(2S,3S)-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one | CAS: CAS:142797-34-0 |
| Chembl ID: CHEMBL592675 | Pubchem ID: CID:1548994 |
| Formula: C25H22O10 | TCM-ID: TCMC2080 |
| Smiles: COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O | |
| Alias:
(2R,3R)-2-[(2S,3S)-2,3-Dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one;
1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.; NSC 227190; Silibinin B; Silybin B; Silybin a1 |
Structure:
|
Related Targets (Total: 32)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T60QJ3 | ATP-binding cassette sub-family B member 5 | ABCB5 |
Q2M3G0 |
A | 1 Reference(s) |
| T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
A | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
A | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
A | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
A | 1 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
| T05O6O | Estrogen receptor beta | ESR2 |
Q92731 |
A | 1 Reference(s) |
| T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T24U57 | E-selectin | SELE |
P16581 |
C | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T30KQB | Alanine aminotransferase 1 | GPT |
P24298 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T14XGP | Protocadherin alpha-C2 | PCDHAC2 |
Q9Y5I4 |
C | 1 Reference(s) |
| T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
C | 1 Reference(s) |
| T86UXL | Cyclin-A2 | CCNA2 |
P20248 |
C | 1 Reference(s) |
| T31EJG | Apoptotic protease-activating factor 1 | APAF1 |
O14727 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T34DZ7 | Interleukin-2 | IL2 |
P60568 |
C | 1 Reference(s) |
| T28DIY | Immunoglobulin heavy constant epsilon | IGHE |
P01854 |
C | 1 Reference(s) |
| T87JTM | Sialin | SLC17A5 |
Q9NRA2 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0484 | Shui Fei Ji | 水飞蓟 | St marys | Silybum marianum |
Ckey description of the interaction between compound and target