Compound Description
| ID: C0409 | Common name: S-Nitrosoglutathione |
| IUPAC: (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-nitrososulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid | CAS: CAS:57564-91-7 |
| Chembl ID: CHEMBL63507 | Pubchem ID: CID:104858 |
| Formula: C10H16N4O7S | TCM-ID: TCMC2087 |
| Smiles: O=NSC[C@@H](C(=NCC(=O)O)O)N=C(CC[C@@H](C(=O)O)N)O | |
| Alias:
Glycine, N-(N-L-γ-glutamyl-S-nitroso-L-cysteinyl)-;
L-γ-Glutamyl-S-nitroso-L-cysteinylglycine; GSNO; Nitrosoglutathione; RVC 588; RVC 588 (peptide); S-Nitroso-L-glutathione; S-Nitrosoglutathione; S-Nitrosylglutathione; SNOG |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T70VMI | Nitric oxide synthase, brain | NOS1 |
P29475 |
A | 1 Reference(s) |
| T83SRW | Methionine adenosyltransferase 2 subunit beta | MAT2B |
Q9NZL9 |
A | 1 Reference(s) |
| T36B3K | Alcohol dehydrogenase class-3 | ADH5 |
P11766 |
A | 1 Reference(s) |
| T18DUA | Tight junction protein ZO-1 | TJP1 |
Q07157 |
C | 1 Reference(s) |
| T53KY7 | Cystic fibrosis transmembrane conductance regulator | CFTR |
P13569 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target