Compound Description
| ID: C0440 | Common name: Tetrodotoxin |
| IUPAC: NA | CAS: NA |
| Chembl ID: CHEMBL507974 | Pubchem ID: CID:11174599 |
| Formula: C11H17N3O8 | TCM-ID: TCMC2154 |
| Smiles: OC[C@@]1(O)[C@H]2O[C@]3(O[C@@H]1[C@H]1[C@@]([C@@H]2O)([C@@H]3O)NC(=N)N[C@@H]1O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T77X36 | Sodium channel protein type 5 subunit alpha | SCN5A |
Q14524 |
A | 1 Reference(s) |
| T85J2J | B2 bradykinin receptor | BDKRB2 |
P30411 |
A | 1 Reference(s) |
| T60XJI | Transient receptor potential cation channel subfamily M member 8 | TRPM8 |
Q7Z2W7 |
A | 1 Reference(s) |
| T15P3B | Transient receptor potential cation channel subfamily V member 2 | TRPV2 |
Q9Y5S1 |
A | 1 Reference(s) |
| T09INZ | Transient receptor potential cation channel subfamily A member 1 | TRPA1 |
O75762 |
A | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1205 | Hu Lu Cha | 葫芦茶 | Triquetrous tadehagi | Tadehagi triquetrum |
Ckey description of the interaction between compound and target