Compound Description
| ID: C0481 | Common name: Verapamil |
| IUPAC: 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]-2-propan-2-ylpentanenitrile | CAS: CAS:52-53-9 |
| Chembl ID: CHEMBL6966 | Pubchem ID: CID:2520 |
| Formula: C27H38N2O4 | TCM-ID: TCMC2226 |
| Smiles: COc1ccc(cc1OC)CCN(CCCC(c1ccc(c(c1)OC)OC)(C(C)C)C#N)C | |
| Alias:
Valeronitrile, 5-[(3,4-dimethoxyphenethyl)methylamino]-2-(3,4-dimethoxyphenyl)-2-isopropyl-;
α-[3-[[2-(3,4-Dimethoxyphenyl)ethyl]methylamino]propyl]-3,4-dimethoxy-α-(1-methylethyl)benzeneacetonitrile; (±)-Verapamil; 5-[(3,4-Dimethoxyphenethyl)methylamino]-2-(3,4-dimethoxy phenyl)-2-isopropylvaleronitrile; CP 16533-1; D 365; Iproveratril; Lekoptin; NSC 272306NA; R,S-Verapamil; VPL; Verapamil; dl-Verapamil |
Structure:
|
Related Targets (Total: 9)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T37CIB | ATP-binding cassette sub-family B member 6, mitochondrial | ABCB6 |
Q9NP58 |
A | 2 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 51 Reference(s) |
| T88BCB | Glycerol-3-phosphate phosphatase | PGP |
A6NDG6 |
A | 4 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 3 Reference(s) |
| T60A9R | NA | CYP3A |
NA |
A | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
A | 4 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T39FBA | Thioredoxin-interacting protein | TXNIP |
Q9H3M7 |
A | 1 Reference(s) |
| T21EGX | Multidrug resistance-associated protein 1 | ABCC1 |
P33527 |
A | 2 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target