Compound Description
| ID: C0503 | Common name: Astaxanthin |
| IUPAC: (6S)-6-hydroxy-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(4S)-4-hydroxy-2,6,6-trimethyl-3-oxocyclohexen-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-2,4,4-trimethylcyclohex-2-en-1-one | CAS: CAS:472-61-7 |
| Chembl ID: CHEMBL1255871 | Pubchem ID: CID:5281224 |
| Formula: C40H52O4 | TCM-ID: TCMC2321 |
| Smiles: C/C(=C\C=C\C=C(\C=C\C=C(\C=C\C1=C(C)C(=O)[C@H](CC1(C)C)O)/C)/C)/C=C/C=C(/C=C/C1=C(C)C(=O)[C@H](CC1(C)C)O)\C | |
| Alias:
Astaxanthin;
β-Carotene-4,4'-dione, 3,3'-dihydroxy-, all-trans-; (3S,3'S)-3,3'-Dihydroxy-β,β-carotene-4,4'-dione; (3S,3'S)-Astaxanthin; (3S,3'S)-Astaxanthin; (3S,3'S)-all-trans-Astaxanthin; (S,S)-Astaxanthin; Aquasta; AstaREAL; AstaREAL A1010; AstaXin; Astabio AR 1; Astabio AR 5; Astacarox; Astareal ACT; Astared; Astax S; Astaxanthin, all-trans-; Astots 10O; Astots 5O; Astots ST; BioAstin; BioAstin oleoresin; Carophyll Pink; Lucantin Pink; NatuRose; Natupink; Ovoester; Puresta W 05; Sunactive AX 310; all-trans-(3S,3'S)-Astaxanthin; all-trans-Astaxanthin; trans-Astaxanthin |
Structure:
|
Related Targets (Total: 11)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
A | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
A | 2 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
B | 1 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
C | 1 Reference(s) |
| T08W1L | Tumor necrosis factor receptor superfamily member 16 | NGFR |
P08138 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T70VMI | Nitric oxide synthase, brain | NOS1 |
P29475 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target