Compound Description
| ID: C0506 | Common name: Oridonin |
| IUPAC: NA | CAS: CAS:28957-04-2 |
| Chembl ID: CHEMBL454570 | Pubchem ID: CID:15923208 |
| Formula: C20H28O6 | TCM-ID: TCMC2348 |
| Smiles: C=C1[C@@H]2CC[C@@H]3[C@](C1=O)([C@@H]2O)[C@@]1(O)OC[C@@]23[C@@H](O)CCC([C@H]2[C@@H]1O)(C)C | |
| Alias:
Kaur-16-en-15-one, 7α,20-epoxy-1α,6β,7,14-tetrahydroxy-, (14R)-;
Oridonin; (1α,6β,7α,14R)-7,20-Epoxy-1,6,7,14-tetrahydroxykaur-16-en-15-one; 6,11b-(Epoxymethano)-6a,9-methano-1H-cyclohepta[a]naphthalene, kaur-16-en-15-one deriv.; Isodonol; NSC 250682; Oridonine |
Structure:
|
Related Targets (Total: 17)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
A | 2 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 2 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
| T01N30 | F-box/WD repeat-containing protein 7 | FBXW7 |
Q969H0 |
A | 1 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
A | 1 Reference(s) |
| T41A2B | Nucleolin | NCL |
P19338 |
A | 1 Reference(s) |
| T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
A | 1 Reference(s) |
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
B | 1 Reference(s) |
| T12IEI | Cadherin-2 | CDH2 |
P19022 |
C | 1 Reference(s) |
| T28RI5 | Zinc finger E-box-binding homeobox 1 | ZEB1 |
P37275 |
C | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0617 | Qian Cao Teng | 茜草藤 | NA | Rubia cordifolia |
Ckey description of the interaction between compound and target