Compound Description
| ID: C0600 | Common name: Adenosine |
| IUPAC: (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | CAS: NA |
| Chembl ID: CHEMBL1090 | Pubchem ID: CID:21704 |
| Formula: C10H13N5O4 | TCM-ID: TCMC3139 |
| Smiles: OC[C@H]1O[C@H]([C@H]([C@@H]1O)O)n1cnc2c1ncnc2N | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 7)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T94T7V | Adenosylhomocysteinase | AHCY |
P23526 |
A | 1 Reference(s) |
| T47DYR | P2Y purinoceptor 1 | P2RY1 |
P47900 |
A | 1 Reference(s) |
| T56TFE | 5'-nucleotidase | NT5E |
P21589 |
A | 1 Reference(s) |
| T16BEL | [Pyruvate dehydrogenase | PDK4 |
Q16654 |
C | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
| T94WJB | Endothelial transcription factor GATA-2 | GATA2 |
P23769 |
C | 1 Reference(s) |
| T62FNY | Adenosine receptor A3 | ADORA3 |
P0DMS8 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0938 | Da Suan | 大蒜 | Garlic | Allium sativum |
Ckey description of the interaction between compound and target