Compound Description
| ID: C0605 | Common name: Zingerone |
| IUPAC: 4-(4-hydroxy-3-methoxyphenyl)butan-2-one | CAS: CAS:122-48-5 |
| Chembl ID: CHEMBL25894 | Pubchem ID: CID:31211 |
| Formula: C11H14O3 | TCM-ID: TCMC3161 |
| Smiles: CC(=O)CCC1=CC(=C(C=C1)O)OC | |
| Alias:
4-(4-Hydroxy-3-methoxyphenyl)-2-butanone;
(4-Hydroxy-3-methoxyphenyl)ethyl methyl ketone; 3-Methoxy-4-hydroxybenzylacetone; 4-Hydroxy-3-methoxybenzylacetone; Gingerone; NSC 15335; Vanillylacetone; Zingerone; Zingiberone; [0]-Paradol |
Structure:
|
Related Targets (Total: 5)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
A | 1 Reference(s) |
| T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 1 Reference(s) |
| T31VDH | Myeloid differentiation primary response protein MyD88 | MYD88 |
Q99836 |
C | 1 Reference(s) |
| T43R3A | TIR domain-containing adapter molecule 2 | TICAM2 |
Q86XR7 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0446 | Sheng Jiang | 生姜 | Fresh common ginger | Zingiber officinale |
Ckey description of the interaction between compound and target