Compound Description
| ID: C0646 | Common name: Sophocarpine |
| IUPAC: (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one | CAS: CAS:6483-15-4 |
| Chembl ID: CHEMBL377725 | Pubchem ID: CID:115269 |
| Formula: C15H22N2O | TCM-ID: TCMC3413 |
| Smiles: C1CC2CN3C(CC=CC3=O)C4C2N(C1)CCC4 | |
| Alias:
Matridin-15-one, 13,14-didehydro-;
Sophocarpine; (7aS,13aR,13bR,13cS)-2,3,6,7,7a,8,13,13a,13b,13c-Decahydro-1H,5H,10H-dipyrido[2,1-f |
Structure:
|
Related Targets (Total: 8)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 2 Reference(s) |
| T69RXK | Cytochrome P450 2C9 | CYP2C9 |
P11712 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 1 Reference(s) |
| T28HOM | Leptin | LEP |
P41159 |
C | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target