Compound Description
| ID: C0673 | Common name: 10-Gingerol |
| IUPAC: (5S)-5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one | CAS: NA |
| Chembl ID: CHEMBL549472 | Pubchem ID: CID:168115 |
| Formula: C21H34O4 | TCM-ID: TCMC3633 |
| Smiles: CCCCCCCCC[C@@H](CC(=O)CCc1ccc(c(c1)OC)O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
A | 1 Reference(s) |
| T64QZQ | Erythroid transcription factor | GATA1 |
P15976 |
C | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0446 | Sheng Jiang | 生姜 | Fresh common ginger | Zingiber officinale |
Ckey description of the interaction between compound and target