Compound Description
| ID: C0743 | Common name: Β-Cryptoxanthin |
| IUPAC: (1R)-3,5,5-trimethyl-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohex-3-en-1-ol | CAS: CAS:472-70-8 |
| Chembl ID: NA | Pubchem ID: CID:5281235 |
| Formula: C40H56O | TCM-ID: TCMC4311 |
| Smiles: CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CC(CC2(C)C)O)C)C)C | |
| Alias:
Neo-β-cryptoxanthin;
β-Caroten-3-ol, (R)-all-trans-; (3R)-β,β-Caroten-3-ol; (3R)-Cryptoxanthin; (3R)-β-Cryptoxanthin; 3-Hydroxy-β-carotene; CRP 015; Caricaxanthin; Cryptoxanthin; Cryptoxanthin, all-trans-; Cryptoxanthine; Cryptoxanthol; Cryptoxanthol, all-trans-; E 161c; Kryptoxanthin; Neocryptoxanthin, all-trans-; Neocryptoxanthol, all-trans-; Paprika carotene; Xanthrophyll 1; all-trans-Cryptoxanthin; all-trans-β-Cryptoxanthin; trans-Cryptoxanthin; trans-β-Crytoxanthin; β-Cryptoxanthin; β-Cryptoxanthin, all-trans- |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T46E53 | Retinoic acid receptor alpha | RARA |
P10276 |
C | 1 Reference(s) |
| T61DYZ | Phospholipid-transporting ATPase ABCA1 | ABCA1 |
O95477 |
C | 1 Reference(s) |
| T53U89 | Runt-related transcription factor 1 | RUNX1 |
Q01196 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0095 | Gou Qi Zi | 枸杞子 | Chinese wolfberry fruit | Lycium chinense |
Ckey description of the interaction between compound and target