Compound Description
| ID: C0765 | Common name: Glycitein |
| IUPAC: 7-hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one | CAS: CAS:40957-83-3 |
| Chembl ID: CHEMBL513024 | Pubchem ID: CID:5317750 |
| Formula: C16H12O5 | TCM-ID: TCMC4591 |
| Smiles: COC1=C(C=C2C(=C1)C(=O)C(=CO2)C3=CC=C(C=C3)O)O | |
| Alias:
7-Hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one;
7,4'-Dihydroxy-6-methoxyisoflavone; Glycetein; Glycitein; Glycitin aglycon |
Structure:
|
Related Targets (Total: 3)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T62P0D | Collagenase 3 | MMP13 |
P45452 |
A | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
B | 1 Reference(s) |
| T69OL5 | Neutrophil collagenase | MMP8 |
P22894 |
B | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H1175 | Hei Dou | 黑豆 | Black bean | Semen glycine max |
Ckey description of the interaction between compound and target